About 4-nitrophenanthrene
4-nitrophenanthrene (PubChem CID 139058403) has the molecular formula C28H18N2O4
and a molecular weight of 446.46 g/mol. Its IUPAC name is 4-nitrophenanthrene.
Molecular Properties
| Compound Name | 4-nitrophenanthrene |
| PubChem CID | 139058403 |
| Molecular Formula | C28H18N2O4 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 4-nitrophenanthrene |
| SMILES | O=[N+]([O-])c1cccc2ccc3ccccc3c12.O=[N+]([O-])c1cccc2ccc3ccccc3c12 |
| InChI | InChI=1S/2C14H9NO2/c2*16-15(17)13-7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)13/h2*1-9H |
| InChIKey | XJERLWSEOXEXIJ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrophenanthrene?
The IUPAC name of 4-nitrophenanthrene (CID 139058403) is 4-nitrophenanthrene.
What is the SMILES notation for 4-nitrophenanthrene?
The canonical SMILES for 4-nitrophenanthrene is O=[N+]([O-])c1cccc2ccc3ccccc3c12.O=[N+]([O-])c1cccc2ccc3ccccc3c12.
What is the InChIKey of 4-nitrophenanthrene?
The InChIKey is XJERLWSEOXEXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H9NO2/c2*16-15(17)13-7-3-5-11-9-8-10-4-1-2-6-12(10)14(11)13/h2*1-9H.
What are the key properties of 4-nitrophenanthrene?
4-nitrophenanthrene has a molecular weight of 446.46 g/mol, XLogP of 7.80, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrophenanthrene is sourced from PubChem (CID 139058403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).