About formonitrile;1-nitronaphthalene
formonitrile;1-nitronaphthalene (PubChem CID 174387830) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is formonitrile;1-nitronaphthalene.
Molecular Properties
| Compound Name | formonitrile;1-nitronaphthalene |
| PubChem CID | 174387830 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | formonitrile;1-nitronaphthalene |
| SMILES | C#N.O=[N+]([O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C10H7NO2.CHN/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;1-2/h1-7H;1H |
| InChIKey | DIBVMHDQTJYKSY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formonitrile;1-nitronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;1-nitronaphthalene?
The IUPAC name of formonitrile;1-nitronaphthalene (CID 174387830) is formonitrile;1-nitronaphthalene.
What is the SMILES notation for formonitrile;1-nitronaphthalene?
The canonical SMILES for formonitrile;1-nitronaphthalene is C#N.O=[N+]([O-])c1cccc2ccccc12.
What is the InChIKey of formonitrile;1-nitronaphthalene?
The InChIKey is DIBVMHDQTJYKSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.CHN/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;1-2/h1-7H;1H.
What are the key properties of formonitrile;1-nitronaphthalene?
formonitrile;1-nitronaphthalene has a molecular weight of 200.20 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;1-nitronaphthalene is sourced from PubChem (CID 174387830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).