About 8-nitroisoquinolin-2-ium
8-nitroisoquinolin-2-ium (PubChem CID 21436749) has the molecular formula C9H7N2O2+
and a molecular weight of 175.17 g/mol. Its IUPAC name is 8-nitroisoquinolin-2-ium.
Molecular Properties
| Compound Name | 8-nitroisoquinolin-2-ium |
| PubChem CID | 21436749 |
| Molecular Formula | C9H7N2O2+ |
| Molecular Weight | 175.17 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 8-nitroisoquinolin-2-ium |
| SMILES | O=[N+]([O-])c1cccc2cc[nH+]cc12 |
| InChI | InChI=1S/C9H6N2O2/c12-11(13)9-3-1-2-7-4-5-10-6-8(7)9/h1-6H/p+1 |
| InChIKey | SUXMGKFFQJTYEX-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 57.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitroisoquinolin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitroisoquinolin-2-ium?
The IUPAC name of 8-nitroisoquinolin-2-ium (CID 21436749) is 8-nitroisoquinolin-2-ium.
What is the SMILES notation for 8-nitroisoquinolin-2-ium?
The canonical SMILES for 8-nitroisoquinolin-2-ium is O=[N+]([O-])c1cccc2cc[nH+]cc12.
What is the InChIKey of 8-nitroisoquinolin-2-ium?
The InChIKey is SUXMGKFFQJTYEX-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H6N2O2/c12-11(13)9-3-1-2-7-4-5-10-6-8(7)9/h1-6H/p+1.
What are the key properties of 8-nitroisoquinolin-2-ium?
8-nitroisoquinolin-2-ium has a molecular weight of 175.17 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitroisoquinolin-2-ium is sourced from PubChem (CID 21436749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).