About 1,1'-biphenyl;1-nitronaphthalene
1,1'-biphenyl;1-nitronaphthalene (PubChem CID 174805071) has the molecular formula C22H17NO2
and a molecular weight of 327.38 g/mol. Its IUPAC name is 1,1'-biphenyl;1-nitronaphthalene.
Molecular Properties
| Compound Name | 1,1'-biphenyl;1-nitronaphthalene |
| PubChem CID | 174805071 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1,1'-biphenyl;1-nitronaphthalene |
| SMILES | O=[N+]([O-])c1cccc2ccccc12.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C10H7NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-10H;1-7H |
| InChIKey | SIXOIZPRWKHRQN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;1-nitronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;1-nitronaphthalene?
The IUPAC name of 1,1'-biphenyl;1-nitronaphthalene (CID 174805071) is 1,1'-biphenyl;1-nitronaphthalene.
What is the SMILES notation for 1,1'-biphenyl;1-nitronaphthalene?
The canonical SMILES for 1,1'-biphenyl;1-nitronaphthalene is O=[N+]([O-])c1cccc2ccccc12.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;1-nitronaphthalene?
The InChIKey is SIXOIZPRWKHRQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C10H7NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-10H;1-7H.
What are the key properties of 1,1'-biphenyl;1-nitronaphthalene?
1,1'-biphenyl;1-nitronaphthalene has a molecular weight of 327.38 g/mol, XLogP of 6.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;1-nitronaphthalene is sourced from PubChem (CID 174805071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).