About azanylidyneazanium;1-nitronaphthalene;chloride
azanylidyneazanium;1-nitronaphthalene;chloride (PubChem CID 23454944) has the molecular formula C10H8ClN3O2
and a molecular weight of 237.65 g/mol. Its IUPAC name is azanylidyneazanium;1-nitronaphthalene;chloride.
Molecular Properties
| Compound Name | azanylidyneazanium;1-nitronaphthalene;chloride |
| PubChem CID | 23454944 |
| Molecular Formula | C10H8ClN3O2 |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | azanylidyneazanium;1-nitronaphthalene;chloride |
| SMILES | N#[NH+].O=[N+]([O-])c1cccc2ccccc12.[Cl-] |
| InChI | InChI=1S/C10H7NO2.ClH.N2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;;1-2/h1-7H;1H; |
| InChIKey | ANLKRQAOOKYGOB-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanylidyneazanium;1-nitronaphthalene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanylidyneazanium;1-nitronaphthalene;chloride?
The IUPAC name of azanylidyneazanium;1-nitronaphthalene;chloride (CID 23454944) is azanylidyneazanium;1-nitronaphthalene;chloride.
What is the SMILES notation for azanylidyneazanium;1-nitronaphthalene;chloride?
The canonical SMILES for azanylidyneazanium;1-nitronaphthalene;chloride is N#[NH+].O=[N+]([O-])c1cccc2ccccc12.[Cl-].
What is the InChIKey of azanylidyneazanium;1-nitronaphthalene;chloride?
The InChIKey is ANLKRQAOOKYGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.ClH.N2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;;1-2/h1-7H;1H;.
What are the key properties of azanylidyneazanium;1-nitronaphthalene;chloride?
azanylidyneazanium;1-nitronaphthalene;chloride has a molecular weight of 237.65 g/mol, XLogP of -1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidyneazanium;1-nitronaphthalene;chloride is sourced from PubChem (CID 23454944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).