About (2-azidophenyl)-phenyldiazene;1-nitronaphthalene
(2-azidophenyl)-phenyldiazene;1-nitronaphthalene (PubChem CID 159930527) has the molecular formula C22H16N6O2
and a molecular weight of 396.41 g/mol. Its IUPAC name is (2-azidophenyl)-phenyldiazene;1-nitronaphthalene.
Molecular Properties
| Compound Name | (2-azidophenyl)-phenyldiazene;1-nitronaphthalene |
| PubChem CID | 159930527 |
| Molecular Formula | C22H16N6O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (2-azidophenyl)-phenyldiazene;1-nitronaphthalene |
| SMILES | O=[N+]([O-])c1cccc2ccccc12.[N-]=[N+]=Nc1ccccc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C12H9N5.C10H7NO2/c13-17-16-12-9-5-4-8-11(12)15-14-10-6-2-1-3-7-10;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-9H;1-7H/b15-14+; |
| InChIKey | NZOSULSUAMEDAR-WPDLWGESSA-N |
| XLogP | 7.79 |
| TPSA | 116.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-azidophenyl)-phenyldiazene;1-nitronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-azidophenyl)-phenyldiazene;1-nitronaphthalene?
The IUPAC name of (2-azidophenyl)-phenyldiazene;1-nitronaphthalene (CID 159930527) is (2-azidophenyl)-phenyldiazene;1-nitronaphthalene.
What is the SMILES notation for (2-azidophenyl)-phenyldiazene;1-nitronaphthalene?
The canonical SMILES for (2-azidophenyl)-phenyldiazene;1-nitronaphthalene is O=[N+]([O-])c1cccc2ccccc12.[N-]=[N+]=Nc1ccccc1/N=N/c1ccccc1.
What is the InChIKey of (2-azidophenyl)-phenyldiazene;1-nitronaphthalene?
The InChIKey is NZOSULSUAMEDAR-WPDLWGESSA-N. The full InChI is InChI=1S/C12H9N5.C10H7NO2/c13-17-16-12-9-5-4-8-11(12)15-14-10-6-2-1-3-7-10;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-9H;1-7H/b15-14+;.
What are the key properties of (2-azidophenyl)-phenyldiazene;1-nitronaphthalene?
(2-azidophenyl)-phenyldiazene;1-nitronaphthalene has a molecular weight of 396.41 g/mol, XLogP of 7.79, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-azidophenyl)-phenyldiazene;1-nitronaphthalene is sourced from PubChem (CID 159930527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).