C9H6N4O4S — CID 11448497
5-nitro-1,4-dioxo-3H-phthalazine-2-carbothioamide (PubChem CID 11448497) has the molecular formula C9H6N4O4S and a molecular weight of 266.24 g/mol. Its IUPAC name is 5-nitro-1,4-dioxo-3H-phthalazine-2-carbothioamide.
| Compound Name | 5-nitro-1,4-dioxo-3H-phthalazine-2-carbothioamide |
|---|---|
| PubChem CID | 11448497 |
| Molecular Formula | C9H6N4O4S |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 5-nitro-1,4-dioxo-3H-phthalazine-2-carbothioamide |
| SMILES | NC(=S)n1[nH]c(=O)c2c([N+](=O)[O-])cccc2c1=O |
| InChI | InChI=1S/C9H6N4O4S/c10-9(18)12-8(15)4-2-1-3-5(13(16)17)6(4)7(14)11-12/h1-3H,(H2,10,18)(H,11,14) |
| InChIKey | OMTGLKKMAOXPOC-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|