C15H8N4O8 — CID 175683936
3-(2-hydroxy-3,4-dinitrobenzoyl)-2H-phthalazine-1,4-dione (PubChem CID 175683936) has the molecular formula C15H8N4O8 and a molecular weight of 372.25 g/mol. Its IUPAC name is 3-(2-hydroxy-3,4-dinitrobenzoyl)-2H-phthalazine-1,4-dione.
| Compound Name | 3-(2-hydroxy-3,4-dinitrobenzoyl)-2H-phthalazine-1,4-dione |
|---|---|
| PubChem CID | 175683936 |
| Molecular Formula | C15H8N4O8 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 3-(2-hydroxy-3,4-dinitrobenzoyl)-2H-phthalazine-1,4-dione |
| SMILES | O=C(c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1O)n1[nH]c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C15H8N4O8/c20-12-9(5-6-10(18(24)25)11(12)19(26)27)15(23)17-14(22)8-4-2-1-3-7(8)13(21)16-17/h1-6,20H,(H,16,21) |
| InChIKey | HKPSFFUQIZCSSQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 178.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|