C14H9N3O10 — CID 160869744
2,3-dinitrobenzoic acid;2-nitrobenzoic acid (PubChem CID 160869744) has the molecular formula C14H9N3O10 and a molecular weight of 379.24 g/mol. Its IUPAC name is 2,3-dinitrobenzoic acid;2-nitrobenzoic acid.
| Compound Name | 2,3-dinitrobenzoic acid;2-nitrobenzoic acid |
|---|---|
| PubChem CID | 160869744 |
| Molecular Formula | C14H9N3O10 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2,3-dinitrobenzoic acid;2-nitrobenzoic acid |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1[N+](=O)[O-].O=C(O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H4N2O6.C7H5NO4/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-3H,(H,10,11);1-4H,(H,9,10) |
| InChIKey | SLPHXNFHJQMMPO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 204.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|