C14H6N4NiO12 — CID 175806304
bis(2,3-dinitrobenzoate);nickel(2+) (PubChem CID 175806304) has the molecular formula C14H6N4NiO12 and a molecular weight of 480.91 g/mol. Its IUPAC name is bis(2,3-dinitrobenzoate);nickel(2+).
| Compound Name | bis(2,3-dinitrobenzoate);nickel(2+) |
|---|---|
| PubChem CID | 175806304 |
| Molecular Formula | C14H6N4NiO12 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 479.93 |
| IUPAC Name | bis(2,3-dinitrobenzoate);nickel(2+) |
| SMILES | O=C([O-])c1cccc([N+](=O)[O-])c1[N+](=O)[O-].O=C([O-])c1cccc([N+](=O)[O-])c1[N+](=O)[O-].[Ni+2] |
| InChI | InChI=1S/2C7H4N2O6.Ni/c2*10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15;/h2*1-3H,(H,10,11);/q;;+2/p-2 |
| InChIKey | DVMWQBNSGQTTMW-UHFFFAOYSA-L |
| XLogP | -0.27 |
| TPSA | 252.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|