About silver 3-methyl-2-nitrobenzoate
silver 3-methyl-2-nitrobenzoate (PubChem CID 162078770) has the molecular formula C8H6AgNO4
and a molecular weight of 288.01 g/mol. Its IUPAC name is silver 3-methyl-2-nitrobenzoate.
Molecular Properties
| Compound Name | silver 3-methyl-2-nitrobenzoate |
| PubChem CID | 162078770 |
| Molecular Formula | C8H6AgNO4 |
| Molecular Weight | 288.01 g/mol |
| Exact Mass | 286.93 |
| IUPAC Name | silver 3-methyl-2-nitrobenzoate |
| SMILES | Cc1cccc(C(=O)[O-])c1[N+](=O)[O-].[Ag+] |
| InChI | InChI=1S/C8H7NO4.Ag/c1-5-3-2-4-6(8(10)11)7(5)9(12)13;/h2-4H,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | ZCBDEPONEUTHFL-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.01 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze silver 3-methyl-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 3-methyl-2-nitrobenzoate?
The IUPAC name of silver 3-methyl-2-nitrobenzoate (CID 162078770) is silver 3-methyl-2-nitrobenzoate.
What is the SMILES notation for silver 3-methyl-2-nitrobenzoate?
The canonical SMILES for silver 3-methyl-2-nitrobenzoate is Cc1cccc(C(=O)[O-])c1[N+](=O)[O-].[Ag+].
What is the InChIKey of silver 3-methyl-2-nitrobenzoate?
The InChIKey is ZCBDEPONEUTHFL-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7NO4.Ag/c1-5-3-2-4-6(8(10)11)7(5)9(12)13;/h2-4H,1H3,(H,10,11);/q;+1/p-1.
What are the key properties of silver 3-methyl-2-nitrobenzoate?
silver 3-methyl-2-nitrobenzoate has a molecular weight of 288.01 g/mol, XLogP of 0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silver 3-methyl-2-nitrobenzoate is sourced from PubChem (CID 162078770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).