C8H3NO6-2 — CID 19386615
2-nitrobenzene-1,3-dicarboxylate (PubChem CID 19386615) has the molecular formula C8H3NO6-2 and a molecular weight of 209.11 g/mol. Its IUPAC name is 2-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 2-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 19386615 |
| Molecular Formula | C8H3NO6-2 |
| Molecular Weight | 209.11 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | 2-nitrobenzene-1,3-dicarboxylate |
| SMILES | O=C([O-])c1cccc(C(=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5NO6/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15/h1-3H,(H,10,11)(H,12,13)/p-2 |
| InChIKey | CAHWDGJDQYAFHM-UHFFFAOYSA-L |
| XLogP | -1.68 |
| TPSA | 123.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.11 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|