About 2-ethyl-3-nitrobenzoate
2-ethyl-3-nitrobenzoate (PubChem CID 21114937) has the molecular formula C9H8NO4-
and a molecular weight of 194.17 g/mol. Its IUPAC name is 2-ethyl-3-nitrobenzoate.
Molecular Properties
| Compound Name | 2-ethyl-3-nitrobenzoate |
| PubChem CID | 21114937 |
| Molecular Formula | C9H8NO4- |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-ethyl-3-nitrobenzoate |
| SMILES | CCc1c(C(=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9NO4/c1-2-6-7(9(11)12)4-3-5-8(6)10(13)14/h3-5H,2H2,1H3,(H,11,12)/p-1 |
| InChIKey | RJXOZCVOVYZPMV-UHFFFAOYSA-M |
| XLogP | 0.52 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-nitrobenzoate?
The IUPAC name of 2-ethyl-3-nitrobenzoate (CID 21114937) is 2-ethyl-3-nitrobenzoate.
What is the SMILES notation for 2-ethyl-3-nitrobenzoate?
The canonical SMILES for 2-ethyl-3-nitrobenzoate is CCc1c(C(=O)[O-])cccc1[N+](=O)[O-].
What is the InChIKey of 2-ethyl-3-nitrobenzoate?
The InChIKey is RJXOZCVOVYZPMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H9NO4/c1-2-6-7(9(11)12)4-3-5-8(6)10(13)14/h3-5H,2H2,1H3,(H,11,12)/p-1.
What are the key properties of 2-ethyl-3-nitrobenzoate?
2-ethyl-3-nitrobenzoate has a molecular weight of 194.17 g/mol, XLogP of 0.52, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-nitrobenzoate is sourced from PubChem (CID 21114937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).