C9H7N2O6- — CID 23147658
2-ethyl-3,5-dinitrobenzoate (PubChem CID 23147658) has the molecular formula C9H7N2O6- and a molecular weight of 239.16 g/mol. Its IUPAC name is 2-ethyl-3,5-dinitrobenzoate.
| Compound Name | 2-ethyl-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 23147658 |
| Molecular Formula | C9H7N2O6- |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-ethyl-3,5-dinitrobenzoate |
| SMILES | CCc1c(C(=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N2O6/c1-2-6-7(9(12)13)3-5(10(14)15)4-8(6)11(16)17/h3-4H,2H2,1H3,(H,12,13)/p-1 |
| InChIKey | IMVBFASWKZUFQC-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 126.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|