C14H22N4O7 — CID 19795399
N-ethyl-N-propan-2-ylpropan-2-amine;2,4,6-trinitrophenol (PubChem CID 19795399) has the molecular formula C14H22N4O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-ethyl-N-propan-2-ylpropan-2-amine;2,4,6-trinitrophenol.
| Compound Name | N-ethyl-N-propan-2-ylpropan-2-amine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 19795399 |
| Molecular Formula | C14H22N4O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-ethyl-N-propan-2-ylpropan-2-amine;2,4,6-trinitrophenol |
| SMILES | CCN(C(C)C)C(C)C.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H19N.C6H3N3O7/c1-6-9(7(2)3)8(4)5;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h7-8H,6H2,1-5H3;1-2,10H |
| InChIKey | CEJMBXISNUCCIP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|