C18H22N4O7 — CID 154879172
N,N-diethyl-2,6-dimethylaniline;2,4,6-trinitrophenol (PubChem CID 154879172) has the molecular formula C18H22N4O7 and a molecular weight of 406.40 g/mol. Its IUPAC name is N,N-diethyl-2,6-dimethylaniline;2,4,6-trinitrophenol.
| Compound Name | N,N-diethyl-2,6-dimethylaniline;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 154879172 |
| Molecular Formula | C18H22N4O7 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N,N-diethyl-2,6-dimethylaniline;2,4,6-trinitrophenol |
| SMILES | CCN(CC)c1c(C)cccc1C.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H19N.C6H3N3O7/c1-5-13(6-2)12-10(3)8-7-9-11(12)4;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h7-9H,5-6H2,1-4H3;1-2,10H |
| InChIKey | VDBFNDXCIAHRBG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|