C10H9NO6 — CID 154119897
2-ethyl-5-nitrobenzene-1,3-dicarboxylic acid (PubChem CID 154119897) has the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. Its IUPAC name is 2-ethyl-5-nitrobenzene-1,3-dicarboxylic acid.
| Compound Name | 2-ethyl-5-nitrobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 154119897 |
| Molecular Formula | C10H9NO6 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-ethyl-5-nitrobenzene-1,3-dicarboxylic acid |
| SMILES | CCc1c(C(=O)O)cc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C10H9NO6/c1-2-6-7(9(12)13)3-5(11(16)17)4-8(6)10(14)15/h3-4H,2H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | QEXVCKIFPMNTLF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|