C11H12N2O5S — CID 57138084
S-ethyl 2-ethyl-3,5-dinitrobenzenecarbothioate (PubChem CID 57138084) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is S-ethyl 2-ethyl-3,5-dinitrobenzenecarbothioate.
| Compound Name | S-ethyl 2-ethyl-3,5-dinitrobenzenecarbothioate |
|---|---|
| PubChem CID | 57138084 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | S-ethyl 2-ethyl-3,5-dinitrobenzenecarbothioate |
| SMILES | CCSC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1CC |
| InChI | InChI=1S/C11H12N2O5S/c1-3-8-9(11(14)19-4-2)5-7(12(15)16)6-10(8)13(17)18/h5-6H,3-4H2,1-2H3 |
| InChIKey | BPOLNEZGMWSOQU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|