C16H19N3O9S2 — CID 14910753
dimethyl 2-ethylsulfanyl-2-(2-ethylsulfanylcarbonyl-3,5-dinitroanilino)propanedioate (PubChem CID 14910753) has the molecular formula C16H19N3O9S2 and a molecular weight of 461.47 g/mol. Its IUPAC name is dimethyl 2-ethylsulfanyl-2-(2-ethylsulfanylcarbonyl-3,5-dinitroanilino)propanedioate.
| Compound Name | dimethyl 2-ethylsulfanyl-2-(2-ethylsulfanylcarbonyl-3,5-dinitroanilino)propanedioate |
|---|---|
| PubChem CID | 14910753 |
| Molecular Formula | C16H19N3O9S2 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | dimethyl 2-ethylsulfanyl-2-(2-ethylsulfanylcarbonyl-3,5-dinitroanilino)propanedioate |
| SMILES | CCSC(=O)c1c(NC(SCC)(C(=O)OC)C(=O)OC)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O9S2/c1-5-29-13(20)12-10(7-9(18(23)24)8-11(12)19(25)26)17-16(30-6-2,14(21)27-3)15(22)28-4/h7-8,17H,5-6H2,1-4H3 |
| InChIKey | RCLSEGDSUZJFBV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 167.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|