C15H13N3O5S — CID 10641372
2-benzylsulfanyl-N-methyl-4,6-dinitrobenzamide (PubChem CID 10641372) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-methyl-4,6-dinitrobenzamide.
| Compound Name | 2-benzylsulfanyl-N-methyl-4,6-dinitrobenzamide |
|---|---|
| PubChem CID | 10641372 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-benzylsulfanyl-N-methyl-4,6-dinitrobenzamide |
| SMILES | CNC(=O)c1c(SCc2ccccc2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O5S/c1-16-15(19)14-12(18(22)23)7-11(17(20)21)8-13(14)24-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,16,19) |
| InChIKey | YIJXRQKENYYXEY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|