C18H18N2O4S — CID 59451769
1-[(4-benzylsulfanyl-3-nitrophenyl)methyl]azetidine-3-carboxylic acid (PubChem CID 59451769) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-[(4-benzylsulfanyl-3-nitrophenyl)methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[(4-benzylsulfanyl-3-nitrophenyl)methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 59451769 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-[(4-benzylsulfanyl-3-nitrophenyl)methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc(SCc3ccccc3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C18H18N2O4S/c21-18(22)15-10-19(11-15)9-14-6-7-17(16(8-14)20(23)24)25-12-13-4-2-1-3-5-13/h1-8,15H,9-12H2,(H,21,22) |
| InChIKey | JDDSEZKZBZUVGO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|