C27H25NO2 — CID 57344575
1-[[4-(3,4-diphenylbut-1-ynyl)phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 57344575) has the molecular formula C27H25NO2 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-[[4-(3,4-diphenylbut-1-ynyl)phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-(3,4-diphenylbut-1-ynyl)phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 57344575 |
| Molecular Formula | C27H25NO2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-[[4-(3,4-diphenylbut-1-ynyl)phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc(C#CC(Cc3ccccc3)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C27H25NO2/c29-27(30)26-19-28(20-26)18-23-13-11-21(12-14-23)15-16-25(24-9-5-2-6-10-24)17-22-7-3-1-4-8-22/h1-14,25-26H,17-20H2,(H,29,30) |
| InChIKey | HTNSGMCHNSTZQG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|