C11H11N3O6 — CID 66221796
1-[(2,4-dinitrophenyl)methyl]azetidine-3-carboxylic acid (PubChem CID 66221796) has the molecular formula C11H11N3O6 and a molecular weight of 281.22 g/mol. Its IUPAC name is 1-[(2,4-dinitrophenyl)methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[(2,4-dinitrophenyl)methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 66221796 |
| Molecular Formula | C11H11N3O6 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 1-[(2,4-dinitrophenyl)methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C11H11N3O6/c15-11(16)8-5-12(6-8)4-7-1-2-9(13(17)18)3-10(7)14(19)20/h1-3,8H,4-6H2,(H,15,16) |
| InChIKey | NXPBJUYPCOJPNL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|