C13H17ClN2O5 — CID 119904561
1-[(2-methoxy-5-nitrophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 119904561) has the molecular formula C13H17ClN2O5 and a molecular weight of 316.74 g/mol. Its IUPAC name is 1-[(2-methoxy-5-nitrophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[(2-methoxy-5-nitrophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119904561 |
| Molecular Formula | C13H17ClN2O5 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 1-[(2-methoxy-5-nitrophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1CCC(C(=O)O)C1.Cl |
| InChI | InChI=1S/C13H16N2O5.ClH/c1-20-12-3-2-11(15(18)19)6-10(12)8-14-5-4-9(7-14)13(16)17;/h2-3,6,9H,4-5,7-8H2,1H3,(H,16,17);1H |
| InChIKey | FEFGVSTXEXVLAT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|