C14H22ClN3O3 — CID 119919666
1-[(2-methoxy-5-nitrophenyl)methyl]-N-methylpiperidin-3-amine;hydrochloride (PubChem CID 119919666) has the molecular formula C14H22ClN3O3 and a molecular weight of 315.80 g/mol. Its IUPAC name is 1-[(2-methoxy-5-nitrophenyl)methyl]-N-methylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-[(2-methoxy-5-nitrophenyl)methyl]-N-methylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119919666 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-[(2-methoxy-5-nitrophenyl)methyl]-N-methylpiperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(Cc2cc([N+](=O)[O-])ccc2OC)C1.Cl |
| InChI | InChI=1S/C14H21N3O3.ClH/c1-15-12-4-3-7-16(10-12)9-11-8-13(17(18)19)5-6-14(11)20-2;/h5-6,8,12,15H,3-4,7,9-10H2,1-2H3;1H |
| InChIKey | VFPNLXUPTVELQW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|