C13H20ClN3O2 — CID 119918159
N-methyl-1-[(3-nitrophenyl)methyl]piperidin-3-amine;hydrochloride (PubChem CID 119918159) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is N-methyl-1-[(3-nitrophenyl)methyl]piperidin-3-amine;hydrochloride.
| Compound Name | N-methyl-1-[(3-nitrophenyl)methyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119918159 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-methyl-1-[(3-nitrophenyl)methyl]piperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(Cc2cccc([N+](=O)[O-])c2)C1.Cl |
| InChI | InChI=1S/C13H19N3O2.ClH/c1-14-12-5-3-7-15(10-12)9-11-4-2-6-13(8-11)16(17)18;/h2,4,6,8,12,14H,3,5,7,9-10H2,1H3;1H |
| InChIKey | NHVNEJDVJNAHBI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|