C19H20N4O2 — CID 16802949
2-[1-[(3-nitrophenyl)methyl]piperidin-3-yl]-1H-benzimidazole (PubChem CID 16802949) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[1-[(3-nitrophenyl)methyl]piperidin-3-yl]-1H-benzimidazole.
| Compound Name | 2-[1-[(3-nitrophenyl)methyl]piperidin-3-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 16802949 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-[1-[(3-nitrophenyl)methyl]piperidin-3-yl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1cccc(CN2CCCC(c3nc4ccccc4[nH]3)C2)c1 |
| InChI | InChI=1S/C19H20N4O2/c24-23(25)16-7-3-5-14(11-16)12-22-10-4-6-15(13-22)19-20-17-8-1-2-9-18(17)21-19/h1-3,5,7-9,11,15H,4,6,10,12-13H2,(H,20,21) |
| InChIKey | MXYTVVVTEVUNRA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|