C18H18ClN3 — CID 51137111
2-[(3S)-1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]-1H-benzimidazole (PubChem CID 51137111) has the molecular formula C18H18ClN3 and a molecular weight of 311.82 g/mol. Its IUPAC name is 2-[(3S)-1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]-1H-benzimidazole.
| Compound Name | 2-[(3S)-1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 51137111 |
| Molecular Formula | C18H18ClN3 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[(3S)-1-[(3-chlorophenyl)methyl]pyrrolidin-3-yl]-1H-benzimidazole |
| SMILES | Clc1cccc(CN2CC[C@H](c3nc4ccccc4[nH]3)C2)c1 |
| InChI | InChI=1S/C18H18ClN3/c19-15-5-3-4-13(10-15)11-22-9-8-14(12-22)18-20-16-6-1-2-7-17(16)21-18/h1-7,10,14H,8-9,11-12H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | OVRBODIQRFMCNG-AWEZNQCLSA-N |
| XLogP | 4.21 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |