C17H18ClN3S — CID 24731939
2-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-4-yl]-1H-benzimidazole (PubChem CID 24731939) has the molecular formula C17H18ClN3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 2-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 24731939 |
| Molecular Formula | C17H18ClN3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-4-yl]-1H-benzimidazole |
| SMILES | Clc1ccc(CN2CCC(c3nc4ccccc4[nH]3)CC2)s1 |
| InChI | InChI=1S/C17H18ClN3S/c18-16-6-5-13(22-16)11-21-9-7-12(8-10-21)17-19-14-3-1-2-4-15(14)20-17/h1-6,12H,7-11H2,(H,19,20) |
| InChIKey | KCZWMFZLIAWTHD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |