C18H23N5 — CID 74246859
2-[1-[(3-ethyl-1H-pyrazol-5-yl)methyl]piperidin-4-yl]-1H-benzimidazole (PubChem CID 74246859) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-[1-[(3-ethyl-1H-pyrazol-5-yl)methyl]piperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-[(3-ethyl-1H-pyrazol-5-yl)methyl]piperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 74246859 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 2-[1-[(3-ethyl-1H-pyrazol-5-yl)methyl]piperidin-4-yl]-1H-benzimidazole |
| SMILES | CCc1cc(CN2CCC(c3nc4ccccc4[nH]3)CC2)[nH]n1 |
| InChI | InChI=1S/C18H23N5/c1-2-14-11-15(22-21-14)12-23-9-7-13(8-10-23)18-19-16-5-3-4-6-17(16)20-18/h3-6,11,13H,2,7-10,12H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | LILQBTZHILQHPZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |