C20H19F4N3 — CID 24731793
2-[1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazole (PubChem CID 24731793) has the molecular formula C20H19F4N3 and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-[1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 24731793 |
| Molecular Formula | C20H19F4N3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-[1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazole |
| SMILES | Fc1ccc(C(F)(F)F)cc1CN1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C20H19F4N3/c21-16-6-5-15(20(22,23)24)11-14(16)12-27-9-7-13(8-10-27)19-25-17-3-1-2-4-18(17)26-19/h1-6,11,13H,7-10,12H2,(H,25,26) |
| InChIKey | OCKDTVFFNPUFHX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |