C17H21N5 — CID 56787398
2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-4-yl]-1H-benzimidazole (PubChem CID 56787398) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 56787398 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[1-[(1-methylimidazol-2-yl)methyl]piperidin-4-yl]-1H-benzimidazole |
| SMILES | Cn1ccnc1CN1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C17H21N5/c1-21-11-8-18-16(21)12-22-9-6-13(7-10-22)17-19-14-4-2-3-5-15(14)20-17/h2-5,8,11,13H,6-7,9-10,12H2,1H3,(H,19,20) |
| InChIKey | RMIUBFGUTRTXSZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |