C18H20N4 — CID 16798070
2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1H-benzimidazole (PubChem CID 16798070) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 16798070 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]-1H-benzimidazole |
| SMILES | c1ccc(CN2CCC(c3nc4ccccc4[nH]3)CC2)nc1 |
| InChI | InChI=1S/C18H20N4/c1-2-7-17-16(6-1)20-18(21-17)14-8-11-22(12-9-14)13-15-5-3-4-10-19-15/h1-7,10,14H,8-9,11-13H2,(H,20,21) |
| InChIKey | CECRFUQOWCNQCX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |