C33H29N5 — CID 51049790
2-[4-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]phenyl]-3-phenylquinoxaline (PubChem CID 51049790) has the molecular formula C33H29N5 and a molecular weight of 495.63 g/mol. Its IUPAC name is 2-[4-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]phenyl]-3-phenylquinoxaline.
| Compound Name | 2-[4-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]phenyl]-3-phenylquinoxaline |
|---|---|
| PubChem CID | 51049790 |
| Molecular Formula | C33H29N5 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 2-[4-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]phenyl]-3-phenylquinoxaline |
| SMILES | c1ccc(-c2nc3ccccc3nc2-c2ccc(CN3CCC(c4nc5ccccc5[nH]4)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H29N5/c1-2-8-24(9-3-1)31-32(35-28-11-5-4-10-27(28)34-31)25-16-14-23(15-17-25)22-38-20-18-26(19-21-38)33-36-29-12-6-7-13-30(29)37-33/h1-17,26H,18-22H2,(H,36,37) |
| InChIKey | AIOUPQPASMPERR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |