C34H31N5O — CID 51049798
2-[4-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]phenyl]-6-methoxy-3-phenylquinoxaline (PubChem CID 51049798) has the molecular formula C34H31N5O and a molecular weight of 525.66 g/mol. Its IUPAC name is 2-[4-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]phenyl]-6-methoxy-3-phenylquinoxaline.
| Compound Name | 2-[4-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]phenyl]-6-methoxy-3-phenylquinoxaline |
|---|---|
| PubChem CID | 51049798 |
| Molecular Formula | C34H31N5O |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 2-[4-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]phenyl]-6-methoxy-3-phenylquinoxaline |
| SMILES | COc1ccc2nc(-c3ccc(CN4CCC(c5nc6ccccc6[nH]5)CC4)cc3)c(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C34H31N5O/c1-40-27-15-16-30-31(21-27)36-32(24-7-3-2-4-8-24)33(35-30)25-13-11-23(12-14-25)22-39-19-17-26(18-20-39)34-37-28-9-5-6-10-29(28)38-34/h2-16,21,26H,17-20,22H2,1H3,(H,37,38) |
| InChIKey | ILWVKGPVSJOLOP-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |