C19H19Cl2N3 — CID 43981509
2-[1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]-1H-benzimidazole (PubChem CID 43981509) has the molecular formula C19H19Cl2N3 and a molecular weight of 360.29 g/mol. Its IUPAC name is 2-[1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]-1H-benzimidazole.
| Compound Name | 2-[1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 43981509 |
| Molecular Formula | C19H19Cl2N3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-[1-[(2,4-dichlorophenyl)methyl]piperidin-3-yl]-1H-benzimidazole |
| SMILES | Clc1ccc(CN2CCCC(c3nc4ccccc4[nH]3)C2)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2N3/c20-15-8-7-13(16(21)10-15)11-24-9-3-4-14(12-24)19-22-17-5-1-2-6-18(17)23-19/h1-2,5-8,10,14H,3-4,9,11-12H2,(H,22,23) |
| InChIKey | XKFIERQZIQLIPN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |