C24H22N6O3 — CID 169324379
6-(1H-benzimidazol-2-yl)-N-[1-[(3-nitrophenyl)methyl]pyrrolidin-3-yl]pyridine-2-carboxamide (PubChem CID 169324379) has the molecular formula C24H22N6O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is 6-(1H-benzimidazol-2-yl)-N-[1-[(3-nitrophenyl)methyl]pyrrolidin-3-yl]pyridine-2-carboxamide.
| Compound Name | 6-(1H-benzimidazol-2-yl)-N-[1-[(3-nitrophenyl)methyl]pyrrolidin-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169324379 |
| Molecular Formula | C24H22N6O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 6-(1H-benzimidazol-2-yl)-N-[1-[(3-nitrophenyl)methyl]pyrrolidin-3-yl]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCN(Cc2cccc([N+](=O)[O-])c2)C1)c1cccc(-c2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C24H22N6O3/c31-24(22-10-4-9-21(26-22)23-27-19-7-1-2-8-20(19)28-23)25-17-11-12-29(15-17)14-16-5-3-6-18(13-16)30(32)33/h1-10,13,17H,11-12,14-15H2,(H,25,31)(H,27,28) |
| InChIKey | IRGHXLUULPVGRG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|