C13H17ClN2O4 — CID 174766301
3-nitro-4-(piperidin-1-ylmethyl)benzoic acid;hydrochloride (PubChem CID 174766301) has the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. Its IUPAC name is 3-nitro-4-(piperidin-1-ylmethyl)benzoic acid;hydrochloride.
| Compound Name | 3-nitro-4-(piperidin-1-ylmethyl)benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 174766301 |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-nitro-4-(piperidin-1-ylmethyl)benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(CN2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N2O4.ClH/c16-13(17)10-4-5-11(12(8-10)15(18)19)9-14-6-2-1-3-7-14;/h4-5,8H,1-3,6-7,9H2,(H,16,17);1H |
| InChIKey | PAXJKMGGYPHODR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|