C13H19Cl2N3O4 — CID 68980738
4-[(4-methylpiperazin-1-yl)methyl]-3-nitrobenzoic acid;dihydrochloride (PubChem CID 68980738) has the molecular formula C13H19Cl2N3O4 and a molecular weight of 352.22 g/mol. Its IUPAC name is 4-[(4-methylpiperazin-1-yl)methyl]-3-nitrobenzoic acid;dihydrochloride.
| Compound Name | 4-[(4-methylpiperazin-1-yl)methyl]-3-nitrobenzoic acid;dihydrochloride |
|---|---|
| PubChem CID | 68980738 |
| Molecular Formula | C13H19Cl2N3O4 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-[(4-methylpiperazin-1-yl)methyl]-3-nitrobenzoic acid;dihydrochloride |
| SMILES | CN1CCN(Cc2ccc(C(=O)O)cc2[N+](=O)[O-])CC1.Cl.Cl |
| InChI | InChI=1S/C13H17N3O4.2ClH/c1-14-4-6-15(7-5-14)9-11-3-2-10(13(17)18)8-12(11)16(19)20;;/h2-3,8H,4-7,9H2,1H3,(H,17,18);2*1H |
| InChIKey | CXZMEXYFTRWLJF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|