About 3-nitro-4-pentylbenzoic acid
3-nitro-4-pentylbenzoic acid (PubChem CID 70306199) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is 3-nitro-4-pentylbenzoic acid.
Molecular Properties
| Compound Name | 3-nitro-4-pentylbenzoic acid |
| PubChem CID | 70306199 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 3-nitro-4-pentylbenzoic acid |
| SMILES | CCCCCc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15NO4/c1-2-3-4-5-9-6-7-10(12(14)15)8-11(9)13(16)17/h6-8H,2-5H2,1H3,(H,14,15) |
| InChIKey | JYLIATWMBAGNKL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-4-pentylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-4-pentylbenzoic acid?
The IUPAC name of 3-nitro-4-pentylbenzoic acid (CID 70306199) is 3-nitro-4-pentylbenzoic acid.
What is the SMILES notation for 3-nitro-4-pentylbenzoic acid?
The canonical SMILES for 3-nitro-4-pentylbenzoic acid is CCCCCc1ccc(C(=O)O)cc1[N+](=O)[O-].
What is the InChIKey of 3-nitro-4-pentylbenzoic acid?
The InChIKey is JYLIATWMBAGNKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-2-3-4-5-9-6-7-10(12(14)15)8-11(9)13(16)17/h6-8H,2-5H2,1H3,(H,14,15).
What are the key properties of 3-nitro-4-pentylbenzoic acid?
3-nitro-4-pentylbenzoic acid has a molecular weight of 237.25 g/mol, XLogP of 3.03, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-4-pentylbenzoic acid is sourced from PubChem (CID 70306199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).