About 3-bromo-4-octylbenzoic acid
3-bromo-4-octylbenzoic acid (PubChem CID 23333446) has the molecular formula C15H21BrO2
and a molecular weight of 313.23 g/mol. Its IUPAC name is 3-bromo-4-octylbenzoic acid.
Molecular Properties
| Compound Name | 3-bromo-4-octylbenzoic acid |
| PubChem CID | 23333446 |
| Molecular Formula | C15H21BrO2 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-bromo-4-octylbenzoic acid |
| SMILES | CCCCCCCCc1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C15H21BrO2/c1-2-3-4-5-6-7-8-12-9-10-13(15(17)18)11-14(12)16/h9-11H,2-8H2,1H3,(H,17,18) |
| InChIKey | QQCSPOAEHVPFSP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-octylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-octylbenzoic acid?
The IUPAC name of 3-bromo-4-octylbenzoic acid (CID 23333446) is 3-bromo-4-octylbenzoic acid.
What is the SMILES notation for 3-bromo-4-octylbenzoic acid?
The canonical SMILES for 3-bromo-4-octylbenzoic acid is CCCCCCCCc1ccc(C(=O)O)cc1Br.
What is the InChIKey of 3-bromo-4-octylbenzoic acid?
The InChIKey is QQCSPOAEHVPFSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrO2/c1-2-3-4-5-6-7-8-12-9-10-13(15(17)18)11-14(12)16/h9-11H,2-8H2,1H3,(H,17,18).
What are the key properties of 3-bromo-4-octylbenzoic acid?
3-bromo-4-octylbenzoic acid has a molecular weight of 313.23 g/mol, XLogP of 5.05, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-octylbenzoic acid is sourced from PubChem (CID 23333446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).