C16H24BrNO2 — CID 102767374
3-bromo-4-[[pentyl(propan-2-yl)amino]methyl]benzoic acid (PubChem CID 102767374) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 3-bromo-4-[[pentyl(propan-2-yl)amino]methyl]benzoic acid.
| Compound Name | 3-bromo-4-[[pentyl(propan-2-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 102767374 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3-bromo-4-[[pentyl(propan-2-yl)amino]methyl]benzoic acid |
| SMILES | CCCCCN(Cc1ccc(C(=O)O)cc1Br)C(C)C |
| InChI | InChI=1S/C16H24BrNO2/c1-4-5-6-9-18(12(2)3)11-14-8-7-13(16(19)20)10-15(14)17/h7-8,10,12H,4-6,9,11H2,1-3H3,(H,19,20) |
| InChIKey | SBRQQLPQBLTSRM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|