C17H26BrNO2 — CID 102767391
methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate (PubChem CID 102767391) has the molecular formula C17H26BrNO2 and a molecular weight of 356.30 g/mol. Its IUPAC name is methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 102767391 |
| Molecular Formula | C17H26BrNO2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate |
| SMILES | CCCCN(Cc1ccc(C(=O)OC)cc1Br)C(C)CC |
| InChI | InChI=1S/C17H26BrNO2/c1-5-7-10-19(13(3)6-2)12-15-9-8-14(11-16(15)18)17(20)21-4/h8-9,11,13H,5-7,10,12H2,1-4H3 |
| InChIKey | XOLOMDLRFYZPMT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |