methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate

C17H26BrNO2 — CID 102767391

IUPACmethyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate
SMILESCCCCN(Cc1ccc(C(=O)OC)cc1Br)C(C)CC
InChIInChI=1S/C17H26BrNO2/c1-5-7-10-19(13(3)6-2)12-15-9-8-14(11-16(15)18)17(20)21-4/h8-9,11,13H,5-7,10,12H2,1-4H3
InChIKeyXOLOMDLRFYZPMT-UHFFFAOYSA-N
MW356.30 g/mol
LogP4.64
Rot. Bonds8

About methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate

methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate (PubChem CID 102767391) has the molecular formula C17H26BrNO2 and a molecular weight of 356.30 g/mol. Its IUPAC name is methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate.

Molecular Properties

Compound Namemethyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate
PubChem CID102767391
Molecular FormulaC17H26BrNO2
Molecular Weight356.30 g/mol
Exact Mass355.11
IUPAC Namemethyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate
SMILESCCCCN(Cc1ccc(C(=O)OC)cc1Br)C(C)CC
InChIInChI=1S/C17H26BrNO2/c1-5-7-10-19(13(3)6-2)12-15-9-8-14(11-16(15)18)17(20)21-4/h8-9,11,13H,5-7,10,12H2,1-4H3
InChIKeyXOLOMDLRFYZPMT-UHFFFAOYSA-N
XLogP4.64
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500356.30
LogP ≤ 54.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate?
The IUPAC name of methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate (CID 102767391) is methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate.
What is the SMILES notation for methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate?
The canonical SMILES for methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate is CCCCN(Cc1ccc(C(=O)OC)cc1Br)C(C)CC.
What is the InChIKey of methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate?
The InChIKey is XOLOMDLRFYZPMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26BrNO2/c1-5-7-10-19(13(3)6-2)12-15-9-8-14(11-16(15)18)17(20)21-4/h8-9,11,13H,5-7,10,12H2,1-4H3.
What are the key properties of methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate?
methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate has a molecular weight of 356.30 g/mol, XLogP of 4.64, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-4-[[butan-2-yl(butyl)amino]methyl]benzoate is sourced from PubChem (CID 102767391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).