C14H22BrNO4 — CID 145134119
methoxymethane;methyl 3-bromo-4-[[2-hydroxyethyl(methyl)amino]methyl]benzoate (PubChem CID 145134119) has the molecular formula C14H22BrNO4 and a molecular weight of 348.24 g/mol. Its IUPAC name is methoxymethane;methyl 3-bromo-4-[[2-hydroxyethyl(methyl)amino]methyl]benzoate.
| Compound Name | methoxymethane;methyl 3-bromo-4-[[2-hydroxyethyl(methyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 145134119 |
| Molecular Formula | C14H22BrNO4 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | methoxymethane;methyl 3-bromo-4-[[2-hydroxyethyl(methyl)amino]methyl]benzoate |
| SMILES | COC.COC(=O)c1ccc(CN(C)CCO)c(Br)c1 |
| InChI | InChI=1S/C12H16BrNO3.C2H6O/c1-14(5-6-15)8-10-4-3-9(7-11(10)13)12(16)17-2;1-3-2/h3-4,7,15H,5-6,8H2,1-2H3;1-2H3 |
| InChIKey | YZWRKCQCTOSPKU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |