C17H24BrNO2 — CID 102767216
methyl 3-bromo-4-[[cyclohexylmethyl(methyl)amino]methyl]benzoate (PubChem CID 102767216) has the molecular formula C17H24BrNO2 and a molecular weight of 354.29 g/mol. Its IUPAC name is methyl 3-bromo-4-[[cyclohexylmethyl(methyl)amino]methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[[cyclohexylmethyl(methyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 102767216 |
| Molecular Formula | C17H24BrNO2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | methyl 3-bromo-4-[[cyclohexylmethyl(methyl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C)CC2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C17H24BrNO2/c1-19(11-13-6-4-3-5-7-13)12-15-9-8-14(10-16(15)18)17(20)21-2/h8-10,13H,3-7,11-12H2,1-2H3 |
| InChIKey | OOBUNAVTAULBLK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |