C15H21BrFN — CID 63458821
N-[(2-bromo-4-fluorophenyl)methyl]-1-cyclohexyl-N-methylmethanamine (PubChem CID 63458821) has the molecular formula C15H21BrFN and a molecular weight of 314.24 g/mol. Its IUPAC name is N-[(2-bromo-4-fluorophenyl)methyl]-1-cyclohexyl-N-methylmethanamine.
| Compound Name | N-[(2-bromo-4-fluorophenyl)methyl]-1-cyclohexyl-N-methylmethanamine |
|---|---|
| PubChem CID | 63458821 |
| Molecular Formula | C15H21BrFN |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[(2-bromo-4-fluorophenyl)methyl]-1-cyclohexyl-N-methylmethanamine |
| SMILES | CN(Cc1ccc(F)cc1Br)CC1CCCCC1 |
| InChI | InChI=1S/C15H21BrFN/c1-18(10-12-5-3-2-4-6-12)11-13-7-8-14(17)9-15(13)16/h7-9,12H,2-6,10-11H2,1H3 |
| InChIKey | KMZOAZVMWDBJNG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |