methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate

C16H22BrNO2 — CID 102766971

IUPACmethyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate
SMILESCOC(=O)c1ccc(CN2C(C)CCCC2C)c(Br)c1
InChIInChI=1S/C16H22BrNO2/c1-11-5-4-6-12(2)18(11)10-14-8-7-13(9-15(14)17)16(19)20-3/h7-9,11-12H,4-6,10H2,1-3H3
InChIKeyXWBLUVUCEQWPTI-UHFFFAOYSA-N
MW340.26 g/mol
LogP4.00
Rot. Bonds3

About methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate

methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate (PubChem CID 102766971) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate.

Molecular Properties

Compound Namemethyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate
PubChem CID102766971
Molecular FormulaC16H22BrNO2
Molecular Weight340.26 g/mol
Exact Mass339.08
IUPAC Namemethyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate
SMILESCOC(=O)c1ccc(CN2C(C)CCCC2C)c(Br)c1
InChIInChI=1S/C16H22BrNO2/c1-11-5-4-6-12(2)18(11)10-14-8-7-13(9-15(14)17)16(19)20-3/h7-9,11-12H,4-6,10H2,1-3H3
InChIKeyXWBLUVUCEQWPTI-UHFFFAOYSA-N
XLogP4.00
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.26
LogP ≤ 54.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate?
The IUPAC name of methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate (CID 102766971) is methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate.
What is the SMILES notation for methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate?
The canonical SMILES for methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate is COC(=O)c1ccc(CN2C(C)CCCC2C)c(Br)c1.
What is the InChIKey of methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate?
The InChIKey is XWBLUVUCEQWPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNO2/c1-11-5-4-6-12(2)18(11)10-14-8-7-13(9-15(14)17)16(19)20-3/h7-9,11-12H,4-6,10H2,1-3H3.
What are the key properties of methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate?
methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate has a molecular weight of 340.26 g/mol, XLogP of 4.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate is sourced from PubChem (CID 102766971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).