C16H22BrNO2 — CID 102766971
methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate (PubChem CID 102766971) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 102766971 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | methyl 3-bromo-4-[(2,6-dimethylpiperidin-1-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(C)CCCC2C)c(Br)c1 |
| InChI | InChI=1S/C16H22BrNO2/c1-11-5-4-6-12(2)18(11)10-14-8-7-13(9-15(14)17)16(19)20-3/h7-9,11-12H,4-6,10H2,1-3H3 |
| InChIKey | XWBLUVUCEQWPTI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |