C16H21BrO3 — CID 102765436
methyl 3-bromo-4-[(3-methylcyclohexyl)oxymethyl]benzoate (PubChem CID 102765436) has the molecular formula C16H21BrO3 and a molecular weight of 341.25 g/mol. Its IUPAC name is methyl 3-bromo-4-[(3-methylcyclohexyl)oxymethyl]benzoate.
| Compound Name | methyl 3-bromo-4-[(3-methylcyclohexyl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 102765436 |
| Molecular Formula | C16H21BrO3 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | methyl 3-bromo-4-[(3-methylcyclohexyl)oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COC2CCCC(C)C2)c(Br)c1 |
| InChI | InChI=1S/C16H21BrO3/c1-11-4-3-5-14(8-11)20-10-13-7-6-12(9-15(13)17)16(18)19-2/h6-7,9,11,14H,3-5,8,10H2,1-2H3 |
| InChIKey | HPEAVZIYUHMERJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |