methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate

C16H22BrNO2 — CID 102767604

IUPACmethyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate
SMILESCOC(=O)c1ccc(CN2CCC(C)(C)CC2)c(Br)c1
InChIInChI=1S/C16H22BrNO2/c1-16(2)6-8-18(9-7-16)11-13-5-4-12(10-14(13)17)15(19)20-3/h4-5,10H,6-9,11H2,1-3H3
InChIKeyAYYHMHJHZSDDSG-UHFFFAOYSA-N
MW340.26 g/mol
LogP3.86
Rot. Bonds3

About methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate

methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate (PubChem CID 102767604) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate.

Molecular Properties

Compound Namemethyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate
PubChem CID102767604
Molecular FormulaC16H22BrNO2
Molecular Weight340.26 g/mol
Exact Mass339.08
IUPAC Namemethyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate
SMILESCOC(=O)c1ccc(CN2CCC(C)(C)CC2)c(Br)c1
InChIInChI=1S/C16H22BrNO2/c1-16(2)6-8-18(9-7-16)11-13-5-4-12(10-14(13)17)15(19)20-3/h4-5,10H,6-9,11H2,1-3H3
InChIKeyAYYHMHJHZSDDSG-UHFFFAOYSA-N
XLogP3.86
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.26
LogP ≤ 53.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate?
The IUPAC name of methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate (CID 102767604) is methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate.
What is the SMILES notation for methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate?
The canonical SMILES for methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate is COC(=O)c1ccc(CN2CCC(C)(C)CC2)c(Br)c1.
What is the InChIKey of methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate?
The InChIKey is AYYHMHJHZSDDSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNO2/c1-16(2)6-8-18(9-7-16)11-13-5-4-12(10-14(13)17)15(19)20-3/h4-5,10H,6-9,11H2,1-3H3.
What are the key properties of methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate?
methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate has a molecular weight of 340.26 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-4-[(4,4-dimethylpiperidin-1-yl)methyl]benzoate is sourced from PubChem (CID 102767604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).