C16H21BrN2O2 — CID 102767939
methyl 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-bromobenzoate (PubChem CID 102767939) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is methyl 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-bromobenzoate.
| Compound Name | methyl 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-bromobenzoate |
|---|---|
| PubChem CID | 102767939 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | methyl 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-3-bromobenzoate |
| SMILES | COC(=O)c1ccc(CN2CCN3CCCC3C2)c(Br)c1 |
| InChI | InChI=1S/C16H21BrN2O2/c1-21-16(20)12-4-5-13(15(17)9-12)10-18-7-8-19-6-2-3-14(19)11-18/h4-5,9,14H,2-3,6-8,10-11H2,1H3 |
| InChIKey | RMASLTJPQWEZJJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |